Long-form identifier:
mindat:1:2:11291:9
French:
Hamarøy, Nordland, Norvège
German:
Hamarøy, Nordland, Norwegen
Italian:
Hamarøy, Nordland, Norvegia
Northern Sami:
Hábmir, Nordlánda, Norga
Norwegian:
Hamarøy, Nordland, Norge
Russian:
Хамарёй, Нурланн, Норвегия
Simplified Chinese:
哈馬略, 诺尔兰郡, 挪威
Spanish:
Hamarøy, Nordland, Noruega
Albanian:
Hamarøy, Nordland, Norvegjia
Asturian:
Hamarøy, Nordland, Noruega
Basque:
Hamarøy, Nordland, Norvegia
Bishnupriya Manipuri:
হামারায়, নোর্দলেন্ড, নরৱে
Catalan:
Hamarøy, Nordland, Noruega
Cebuano:
Hamarøy, Nordland Fylke, Norway
Danish:
Hamarøy, Nordland, Norge
Dutch:
Hamarøy, Nordland, Noorwegen
Esperanto:
Hamarøy, Nordland, Norvegio
Finnish:
Hamarøy, Nordlandin lääni, Norja
Indonesian:
Hamarøy, Nordland, Norwegia
Javanese:
Hamarøy, Norwégia
Latin:
Hamarøy, Nordland, Norvegia
Limburgian:
Hamarøy, Nordland, Noorwege
Low Saxon/Low German:
Kommun Hamarøy, Amt Nordland, Norwegen
Malay:
Hamarøy, Nordland, Norway
Minnan / Hokkien-Taiwanese:
Hamarøy, Nordland, Lo̍k-ui
Norwegian (Nynorsk):
Hamarøy, Nordland fylke, Noreg
Polish:
Hamarøy, Nordland, Norwegia
Portuguese:
Hamarøy, Nordland, Noruega
Romanian:
Hamarøy, Nordland, Norvegia
Slovenian:
Hamarøy, Nordland, Norveška
Swahili:
Hamarøy, Nordland, Norwei
Swedish:
Hamarøy, Nordland fylke, Norge
Vietnamese:
Hamarøy, Nordland, Na Uy
Waray:
Hamarøy, Nordland, Noruega
No description has been added for this locality.
Can you add one?
Select Mineral List Type
Standard
Detailed Gallery
Strunz
Chemical Elements
Commodity List
This is a list of exploitable or exploited mineral commodities recorded from this region.Mineral List
Mineral list contains entries from the region specified including sub-localities
152 valid minerals.
3 (TL) - type locality of valid minerals.
3 erroneous literature entries.
Rock Types Recorded
Note: data is currently VERY limited. Please bear with us while we work towards adding this information!
Rock list contains entries from the region specified including sub-localitiesSelect Rock List Type
Alphabetical List Tree Diagram
Entries shown in red are rocks recorded for this region.
| ⓘ Albite var. Cleavelandite Formula: Na(AlSi3O8) |
| ⓘ Allanite-(Ce) Formula: (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) Localities: Reported from at least 8 localities in this region. |
| ⓘ 'Allanite Group' Formula: (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) Localities: Karlsøy quarry, Finnøya, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayNedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, Norway ? (more information) |
| ⓘ Almandine Formula: Fe2+3Al2(SiO4)3 |
| ⓘ Aluminocerite-(CeCa) Formula: (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 Description: Small rose-colored crystals and irregular grains. Microprobe analysis in 1990 recognized that it was a cerite-(Ce) but with dominant Al in the M site of the structure, (Before first description of the species aluminocerite-(Ce)) |
| ⓘ 'Amphibole Supergroup' Formula: AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ Anatase Formula: TiO2 |
| ⓘ Anglesite Formula: PbSO4 |
| ⓘ Annite Formula: KFe2+3(AlSi3O10)(OH)2 |
| ⓘ Antlerite Formula: Cu3(SO4)(OH)4 |
| ⓘ Aplowite Formula: (Co,Mn,Ni)SO4 · 4H2O |
| ⓘ 'Apophyllite Group' Formula: AB4[Si8O20]X · 8H2O Description: Found by Stein Rørvik (Lødingen) during the campain "Mineraljakt i Nord" in 1988. |
| ⓘ Arsenopyrite Formula: FeAsS Localities: Reported from at least 9 localities in this region. |
| ⓘ Atacamite Formula: Cu2(OH)3Cl |
| ⓘ Azurite Formula: Cu3(CO3)2(OH)2 |
| ⓘ Babingtonite Formula: Ca2Fe2+Fe3+Si5O14(OH) Description: Blak microcrystals found in a fissure in a gneissic rock |
| ⓘ 'Bastnäsite' Formula: (Ce/Nd/Y/REE)(CO3)F Habit: needles and plates in subparallell arrangement in fluocerite-(Ce) Colour: light yellow,transparent Description: Occurs in crystalaggregates intergrown with fluocerite-(Ce) and "yttrofluorite". |
| ⓘ Bastnäsite-(Ce) Formula: Ce(CO3)F Localities: Reported from at least 8 localities in this region. |
| ⓘ Bastnäsite-(Nd) Formula: Nd(CO3)F |
ⓘ Bastnäsite-(Y)Formula: Y(CO3)F Description: Added based on a dealers label. No proof of identification. Might be bastnäsite-(Ce) which is common in yttrian fluorite and confirmed from the locality. |
| ⓘ Bavenite ? Formula: Ca4Be2Al2Si9O26(OH)2 Description: Analyzed by P. Černý in 1970 on a sample of blue beryl (Kristiansen 1974). Methode of analysis not known, may be bohseite (Husdal 2019) |
| ⓘ 'Bavenite-Bohseite Series' |
| ⓘ Bertrandite Formula: Be4(Si2O7)(OH)2 Localities: Store Grønnhola Quarry, Drag, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, Norway |
| ⓘ Beryl Formula: Be3Al2(Si6O18) Localities: Store Grønnhola Quarry, Drag, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayJennyhaugen, Drag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayTiltvika pegmatite, Tiltvika, Hamarøy, Nordland, Norway |
| ⓘ Beryl var. Aquamarine Formula: Be3Al2Si6O18 |
| ⓘ Betpakdalite-CaCa Formula: [Ca2(H2O)17Ca(H2O)6][Mo6+8As5+2Fe3+3O36(OH)] References: Kampf, A. R., Mills, S. J., Rumsey, M. S., Dini, M., Birch, W. D., Spratt, J., Pluth, J. J., Steele, I. M., Jenkins, R. A., Pinch, W. W. (2012) The heteropolymolybdate family: structural relations, nomenclature scheme and new species. Mineralogical Magazine, 76 (5) 1175-1207 doi:10.1180/minmag.2012.076.5.09 |
| ⓘ 'Biotite' Formula: K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 Localities: Reported from at least 6 localities in this region. |
| ⓘ Bismoclite ? Formula: BiOCl Description: Analyzed with XRD, pattern similar to daubreeite |
| ⓘ Bismutite Formula: (BiO)2CO3 Localities: Nedre Kvartsen Quarry, Drag, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, Norway |
| ⓘ Bohseite Formula: Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
| ⓘ Bornite Formula: Cu5FeS4 |
| ⓘ Britholite-(Y) Formula: (Y,Ca)5(SiO4)3OH Localities: Nedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayLagmannsvik, Hamarøy, Nordland, NorwayØvre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayKråkmo, Hamarøy, Nordland, Norway |
| ⓘ Brochantite Formula: Cu4(SO4)(OH)6 |
| ⓘ Brookite Formula: TiO2 |
| ⓘ Calcioancylite-(Ce) Formula: (Ce,Ca,Sr)CO3(OH,H2O) |
| ⓘ Calcite Formula: CaCO3 Localities: Treldebakkgruva, Drag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayNedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, Norway |
| ⓘ Cassiterite Formula: SnO2 |
| ⓘ Cayalsite-(Y) (TL) Formula: CaY6Al2Si4O18F6 Type Locality: References: Malcherek, Thomas, Schlüter, Jochen, Cooper, Mark, Ball, Neil, Husdal, Tomas (2015) Cayalsite-(Y), a new rare-earth calcium aluminium fluorosilicate with OD character. European Journal of Mineralogy, 27 (5) 683-694 doi:10.1127/ejm/2015/0027-2465 |
| ⓘ 'Cayalsite-(Y)-1O' Formula: CaY6Al2Si4O18F6 References: Malcherek, Thomas, Schlüter, Jochen, Cooper, Mark, Ball, Neil, Husdal, Tomas (2015) Cayalsite-(Y), a new rare-earth calcium aluminium fluorosilicate with OD character. European Journal of Mineralogy, 27 (5) 683-694 doi:10.1127/ejm/2015/0027-2465 |
| ⓘ Cerianite-(Ce) Formula: (Ce4+,Th)O2 |
ⓘ Cerite-(CeCa)Formula: (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 Description: Showed to be alumocerite-(Ce) (for further information see under alumocerite-(Ce) |
| ⓘ Cerussite Formula: PbCO3 |
| ⓘ Chabazite-Ca Formula: (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ Chalcocite Formula: Cu2S |
| ⓘ Chalcopyrite Formula: CuFeS2 Localities: Lillebotn copper deposit, Hamarøy, Nordland, NorwayNedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayKråkmo, Hamarøy, Nordland, Norway |
| ⓘ Chamosite Formula: Fe2+5Al(AlSi3O)10(OH)8 Localities: Drag, Hamarøy, Nordland, NorwayTreldebakkgruva, Drag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, Norway |
| ⓘ 'Chlorite Group' |
| ⓘ Chukhrovite-(Y) Formula: Ca3YAl2(SO4)F13 · 12H2O |
| ⓘ Columbite-(Fe) Formula: Fe2+Nb2O6 Localities: Tiltvika pegmatite, Tiltvika, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayErlinggruva, Drag, Hamarøy, Nordland, Norway Description: As inclusions in petscheckite |
| ⓘ 'Columbite-(Fe)-Columbite-(Mn) Series' |
| ⓘ Cookeite Formula: (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ Cryptomelane Formula: K(Mn4+7Mn3+)O16 |
| ⓘ Danalite Formula: Be3Fe2+4(SiO4)3S |
| ⓘ Daubréeite ? Formula: BiO(OH) Description: Analyzed with XRD, pattern similar to bismoclite |
| ⓘ Djurleite Formula: Cu31S16 |
| ⓘ Doyleite Formula: Al(OH)3 |
| ⓘ Dravite Formula: NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) References: Kolitsch, Uwe, Andresen, Peter, Husdal, Tomas Andersen, Ertl, Andreas, Haugen, Astrid, Ellingsen, Hans Vidar, Larsen, Alf Olav (2013) Tourmaline-group minerals from Norway, part II: Occurrences of luinaite-(OH) in Tvedalen, Larvik and Porsgrunn, and fluor-liddicoatite, fluor-elbaite and fluor-schorl at Ågskardet, Nordland. Norsk Bergverksmuseum Skrift, 50. 23-41 |
| ⓘ Epidote Formula: (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) References: Zhou, Haoyang, Müller, Axel, Augland, Lars Eivind, Kristoffersen, Magnus, Erambert, Muriel (2022) Titanite links rare-element (meta-)pegmatite mineralization to Caledonian metamorphism. Geochimica et Cosmochimica Acta, 332. 285-306 doi:10.1016/j.gca.2022.06.014 |
| ⓘ 'Euxenite Group' |
| ⓘ Euxenite-(Y) Formula: (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 Localities: Nikkateltet Quarries, Drag, Hamarøy, Nordland, NorwayDrag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, Norway |
ⓘ 'Feldspar Group'Localities: Reported from at least 7 localities in this region. |
| ⓘ Ferberite Formula: FeWO4 |
| ⓘ Fergusonite-(Y) Formula: YNbO4 |
| ⓘ Ferriallanite-(Ce) Formula: (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) Description: Black grains from association with allanite-(Ce), quartz and feldspar. Identified by microprobe and IR spectra
(Ca0.91Mn0.09)[(Ce0.43La0.25Nd0.11Pr0.07...)Ca0.08](Fe1.51Al1)2Mg0.08)Si13(OH,O)
Cfr also Chukanov et al. (2018) References: Chukanov, Nikita V., Zubkova, Natalia V., Schäfer, Christof, Varlamov, Dmitry A., Ermolaeva, vera N., polekhovsky, Yury S., Jančev, Simeon, Pekov, Igor V., Pushcharovsky, Dmitry Yu. (2018) New data on ferriakasakaite-(La) and related minerals extending the compositional field of the epidote supergroup. European Journal of Mineralogy, 30 (2) 323-332 doi:10.1127/ejm/2018/0030-2716 |
| ⓘ Fersmite Formula: CaNb2O6 |
| ⓘ Fluocerite-(Ce) Formula: CeF3 Description: Described as tysonite by Sverdrup et al (1965) |
| ⓘ Fluorapatite Formula: Ca5(PO4)3F Localities: Kråkmo, Hamarøy, Nordland, NorwayLagmannsvik, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, Norway |
| ⓘ Fluorbritholite-(Y) (TL) Formula: (Y,Ca)5(SiO4)3F Habit: irregular grains and coarse, hexagonal, tabular crystals up to 1 mm Description: embedded in granular aggregates of creamcolored Y-rich fluorite (“yttrofluorite") and allanite-(Ce). |
| ⓘ Fluorcalciobritholite Formula: (Ca,REE)5(SiO4,PO4)3F |
| ⓘ Fluorite Formula: CaF2 |
| ⓘ Fluorite var. Yttrofluorite Formula: (Ca1-xYx)F2+x where 0.05 < x < 0.3 Localities: Reported from at least 7 localities in this region. Habit: masses of minute isotropic grains Colour: greyish-white, sugary Description: Usually intergrown with fluocerite-(Ce). |
| ⓘ Fourmarierite Formula: Pb(UO2)4O3(OH)4 · 4H2O |
| ⓘ Gadolinite-(Y) Formula: Y2Fe2+Be2Si2O10 Localities: Håkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayTreldebakkgruva, Drag, Hamarøy, Nordland, NorwayLagmannsvik, Hamarøy, Nordland, Norway |
| ⓘ Galena Formula: PbS |
| ⓘ 'Garnet Group' Formula: X3Z2(SiO4)3 |
| ⓘ Genthelvite Formula: Be3Zn4(SiO4)3S |
| ⓘ Gibbsite Formula: Al(OH)3 Description: as white pulvurent masses in fissures. |
| ⓘ Goethite Formula: Fe3+O(OH) |
| ⓘ Graphite Formula: C |
| ⓘ Gypsum Formula: CaSO4 · 2H2O |
| ⓘ Halloysite Formula: Al2Si2O5(OH)4 · n(H2O) |
| ⓘ Hellandite-(Y) Formula: (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| ⓘ Hematite Formula: Fe2O3 |
| ⓘ Hessite ? Formula: Ag2Te Description: F. S. Nordrum identified a mineral he called hessite-naumannite (Nordrum (1985) p. 16. |
| ⓘ Hingganite-(Ce) Formula: (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ Hisingerite Formula: Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ Hundholmenite-(Y) Formula: (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
| ⓘ Hydrozincite Formula: Zn5(CO3)2(OH)6 |
| ⓘ Idaite Formula: Cu5FeS6 |
| ⓘ Iimoriite-(Y) Formula: Y2[SiO4][CO3] |
| ⓘ Ilmenite Formula: Fe2+TiO3 Localities: Håkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayTreldebakkgruva, Drag, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, Norway |
| ⓘ Jarosite Formula: KFe3+3(SO4)2(OH)6 |
| ⓘ Kainosite-(Y) Formula: Ca2Y2(SiO3)4(CO3) · H2O Localities: Reported from at least 8 localities in this region. |
| ⓘ Kaolinite Formula: Al2(Si2O5)(OH)4 |
| ⓘ Keiviite-(Y) Formula: Y2Si2O7 |
ⓘ 'K Feldspar'Localities: Nedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayBurma Quarry, Drag, Hamarøy, Nordland, NorwayKarlsøy quarry, Finnøya, Hamarøy, Nordland, Norway |
| ⓘ Kyanite Formula: Al2(SiO4)O |
| ⓘ Lanthanite-(Ce) Formula: Ce2(CO3)3 · 8H2O |
| ⓘ Löllingite Formula: FeAs2 Localities: Nedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayLapplægeret, Drag, Hamarøy, Nordland, NorwayJennyhaugen, Drag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, Norway |
| ⓘ Magnetite Formula: Fe2+Fe3+2O4 Localities: Tiltvika, Hamarøy, Nordland, NorwayKarlsøy quarry, Finnøya, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayGarnet occurrence, Tiltvika, Hamarøy, Nordland, Norway |
| ⓘ Malachite Formula: Cu2(CO3)(OH)2 |
| ⓘ Melanterite Formula: Fe2+(H2O)6SO4 · H2O |
| ⓘ Metastudtite Formula: UO4 · 2H2O |
| ⓘ Microcline Formula: K(AlSi3O8) |
| ⓘ Microcline var. Amazonite Formula: K(AlSi3O8) Localities: Store Grønnhola Quarry, Drag, Hamarøy, Nordland, NorwayDrag, Hamarøy, Nordland, NorwayJennyhaugen, Drag, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, Norway |
| ⓘ 'Microlite Group' Formula: A2-mTa2X6-wZ-n Description: intergrown with tantalite-(Mn) |
| ⓘ Milarite Formula: K(◻H2O)Ca2(Be2Al)[Si12O30] Localities: Hellemobotn, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayNikkateltet Quarries, Drag, Hamarøy, Nordland, NorwayErlinggruva, Drag, Hamarøy, Nordland, Norway |
| ⓘ Mimetite Formula: Pb5(AsO4)3Cl |
| ⓘ Molybdenite Formula: MoS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Monazite-(Ce) Formula: Ce(PO4) Localities: Jennyhaugen, Drag, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayLagmannsvik, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, Norway |
| ⓘ Muscovite Formula: KAl2(AlSi3O10)(OH)2 Localities: Reported from at least 8 localities in this region. |
| ⓘ Native Bismuth Formula: Bi Localities: Nedre Kvartsen Quarry, Drag, Hamarøy, Nordland, NorwayNedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, Norway |
| ⓘ Native Gold Formula: Au |
| ⓘ Native Sulphur Formula: S8 |
| ⓘ Naumannite ? Formula: Ag2Se Description: Nordrum identified a mineral he called hessite-naumannite (Neumann 1985). |
ⓘ Okanoganite-(Y)Formula: (Na,Ca)3(Y,Ce)12Si6B2O27F14 Description: Later showed to be a new mineral, hundholmenite-(Y) |
| ⓘ Opal Formula: SiO2 · nH2O |
| ⓘ Parauranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Perbøeite-(Ce) (TL) Formula: CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 Type Locality: References: Bonazzi, P., Lepore, G. O., Bindi, L., Chopin, C., Husdal, T. A., Medenbach, O. (2014) Perbøeite-(Ce) and alnaperbøeite-(Ce), two new members of the epidote-tornebohmite polysomatic series: Chemistry, structure, dehydrogenation, and clue for a sodian epidote end-member. American Mineralogist, 99 (1) 157-169 doi:10.2138/am.2014.4593 |
| ⓘ Petscheckite Formula: UFe(Nb,Ta)2O8 Habit: Cm-sized masses Colour: Dark grey to black Description: Shows a high content of REEs |
| ⓘ Pharmacosiderite Formula: KFe3+4(AsO4)3(OH)4 · 6-7H2O Localities: Nedre Kvartsen Quarry, Drag, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, NorwayJennyhaugen, Drag, Hamarøy, Nordland, Norway |
| ⓘ Phenakite Formula: Be2SiO4 |
| ⓘ Piemontite Formula: (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ 'Plagioclase' Formula: (Na,Ca)[(Si,Al)AlSi2]O8 Localities: Nedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayKarlsøy quarry, Finnøya, Hamarøy, Nordland, Norway |
| ⓘ Pyrite Formula: FeS2 Localities: Reported from at least 7 localities in this region. |
| ⓘ Pyrophanite Formula: Mn2+TiO3 |
| ⓘ Pyrrhotite Formula: Fe1-xS Localities: Nedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayJennyhaugen, Drag, Hamarøy, Nordland, NorwayDrag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, Norway |
| ⓘ Quartz Formula: SiO2 Description: quartz with < 50 ppm contaminating elements |
| ⓘ Richelsdorfite Formula: Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
| ⓘ Rowlandite-(Y) Formula: (Y,Ce)4Fe2+(Si2O7)2F2 (?) Habit: grains Colour: Pale greenish Description: Only 2 grains has been found (Husdal 2011) |
| ⓘ Rozenite Formula: FeSO4 · 4H2O |
| ⓘ Russellite Formula: Bi2WO6 |
| ⓘ Rutile Formula: TiO2 Localities: Håkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayFjellgruvene, Drag, Hamarøy, Nordland, NorwayDrag, Hamarøy, Nordland, Norway Description: Found in porphyroblasts up to several cm large consisting of quartz, K-feldspar, subordinate albite and a rutile-titanite assemblage. |
| ⓘ Rutile var. Ilmenorutile Formula: (Ti,Nb)O2 |
| ⓘ Rynersonite Formula: CaTa2O6 |
| ⓘ Samarskite-(Y) Formula: YFe3+Nb2O8 |
| ⓘ Scheelite Formula: Ca(WO4) |
| ⓘ Schorl Formula: NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ Schröckingerite Formula: NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| ⓘ Scorodite Formula: Fe3+AsO4 · 2H2O Localities: Nedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayNedre Kvartsen Quarry, Drag, Hamarøy, Nordland, NorwayJennyhaugen, Drag, Hamarøy, Nordland, Norway |
| ⓘ Segnitite Formula: PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ Siderite Formula: FeCO3 |
| ⓘ Spessartine Formula: Mn2+3Al2(SiO4)3 |
| ⓘ Sphalerite Formula: ZnS Localities: Drag, Hamarøy, Nordland, NorwayNedre Eivollen, Eivollen, Drag, Hamarøy, Nordland, NorwayNedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, Norway |
| ⓘ Staurolite Formula: Fe2+2Al9Si4O23(OH) |
| ⓘ Stilbite-Ca Formula: NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ 'Stilbite Subgroup' Formula: M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ Studtite Formula: [(UO2)(O2)(H2O)2] · H2O |
| ⓘ Svabite Formula: Ca5(AsO4)3F Habit: Hexagonal Colour: White Description: In a sample found by P.Chr. Sæbö, from a pegmatite in Hellmofjorden area, Raade identified svabite crystals (to a couple of mm large) in cavities in albite. (Raade 1982, Neumann 1985). |
| ⓘ Synchysite-(Nd) Formula: CaNd(CO3)2F Colour: white |
| ⓘ Synchysite-(Y) Formula: CaY(CO3)2F |
| ⓘ Talc Formula: Mg3Si4O10(OH)2 |
| ⓘ Tantalite-(Mn) Formula: Mn2+Ta2O6 Colour: dark red Description: Poorly developed crystals intergrown with microlite |
| ⓘ 'Tapiolite' Formula: (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ Tengerite-(Y) Formula: Y2(CO3)3 · 2-3H2O Localities: Kråkmo, Hamarøy, Nordland, NorwayLagmannsvik, Hamarøy, Nordland, NorwayErlinggruva, Drag, Hamarøy, Nordland, Norway |
| ⓘ Tennantite-(Fe) Formula: Cu6(Cu4Fe2+2)As4S12S |
| ⓘ Tennantite-(Zn) Formula: Cu6(Cu4Zn2)As4S12S |
| ⓘ Thalénite-(Y) Formula: Y3Si3O10F Description: Fluorthalénite-(Y) and thalénite-(Y) are now longer separate species. Thalénite-(Y) is redefined by IMA in 2014 (IMA 14-D) as a F-dominant species with ideal composition Y3Si3O10F. Specimens from this locality are thus now labelled thalénite-(Y). |
| ⓘ Thorbastnäsite Formula: ThCa(CO3)2F2 · 3H2O |
| ⓘ Thorite Formula: Th(SiO4) Localities: Nedre Lapplægeret Quarry, Lapplægeret, Drag, Hamarøy, Nordland, NorwayHammondgruva, Drag, Hamarøy, Nordland, NorwayKarlsøy quarry, Finnøya, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayHellemobotn, Hamarøy, Nordland, Norway |
| ⓘ Titanite Formula: CaTi(SiO4)O |
| ⓘ Topaz Formula: Al2(SiO4)(F,OH)2 |
| ⓘ Törnebohmite-(Ce) Formula: Ce2Al(SiO4)2(OH) |
| ⓘ Tungstenite Formula: WS2 |
| ⓘ Uraninite Formula: UO2 |
| ⓘ Uranophane Formula: Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ Uranopolycrase Formula: (U4+,Y)(Ti,Nb)2O6 Description: Zhou et al. (2022) identified, in thin sections, a mineral that "coexists with a Ca-rich variant of polycrase [(U,Ca,Y)(Ti,Nb)2O6; referred to as polycrase-II];, This is interpreted by Kvamsdal (2023) as a "uranopolycrase" (U4+,Y)(Ti,Nb)2O6 (misspelled as uranpolycras). References: Zhou, Haoyang, Müller, Axel, Augland, Lars Eivind, Kristoffersen, Magnus, Erambert, Muriel (2022) Titanite links rare-element (meta-)pegmatite mineralization to Caledonian metamorphism. Geochimica et Cosmochimica Acta, 332. 285-306 doi:10.1016/j.gca.2022.06.014 |
| ⓘ Vigezzite Formula: CaNb2O6 |
| ⓘ Vyuntspakhkite-(Y) Formula: (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
| ⓘ Wollastonite Formula: Ca3(Si3O9) |
| ⓘ Wulfenite Formula: Pb(MoO4) |
| ⓘ Xenotime-(Y) Formula: Y(PO4) Localities: Lagmannsvik, Hamarøy, Nordland, NorwayHåkonhals Quarry, Finnøya, Hamarøy, Nordland, NorwayKråkmo, Hamarøy, Nordland, Norway |
| ⓘ Xenotime-(Yb) Formula: Yb(PO4) |
| ⓘ Zavaritskite Formula: (BiO)F |
| ⓘ Zircon Formula: Zr(SiO4) Localities: Reported from at least 6 localities in this region. |
| ⓘ Zircon var. Alvite Formula: Zr(SiO4) |
List of minerals arranged by Strunz 10th Edition classification
| Group 1 - Elements |
|---|
| ⓘ | Native Gold | 1.AA.05 | Au |
| ⓘ | Native Bismuth | 1.CA.05 | Bi |
| ⓘ | Graphite | 1.CB.05a | C |
| ⓘ | Native Sulphur | 1.CC.05 | S8 |
| Group 2 - Sulphides and Sulfosalts |
|---|
| ⓘ | Chalcocite | 2.BA.05 | Cu2S |
| ⓘ | Djurleite | 2.BA.05 | Cu31S16 |
| ⓘ | Bornite | 2.BA.15 | Cu5FeS4 |
| ⓘ | Naumannite ? | 2.BA.55 | Ag2Se |
| ⓘ | Hessite ? | 2.BA.60 | Ag2Te |
| ⓘ | Sphalerite | 2.CB.05a | ZnS |
| ⓘ | Chalcopyrite | 2.CB.10a | CuFeS2 |
| ⓘ | Idaite | 2.CB.15a | Cu5FeS6 |
| ⓘ | Pyrrhotite | 2.CC.10 | Fe1-xS |
| ⓘ | Galena | 2.CD.10 | PbS |
| ⓘ | Molybdenite | 2.EA.30 | MoS2 |
| ⓘ | Tungstenite | 2.EA.30 | WS2 |
| ⓘ | Pyrite | 2.EB.05a | FeS2 |
| ⓘ | Löllingite | 2.EB.15a | FeAs2 |
| ⓘ | Arsenopyrite | 2.EB.20 | FeAsS |
| ⓘ | Tennantite-(Zn) | 2.GB.05 | Cu6(Cu4Zn2)As4S12S |
| ⓘ | Tennantite-(Fe) | 2.GB.05 | Cu6(Cu4Fe2+2)As4S12S |
| Group 3 - Halides |
|---|
| ⓘ | Fluorite | 3.AB.25 | CaF2 |
| ⓘ | var. Yttrofluorite | 3.AB.25 | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
| ⓘ | Fluocerite-(Ce) | 3.AC.15 | CeF3 |
| ⓘ | Chukhrovite-(Y) | 3.CG.10 | Ca3YAl2(SO4)F13 · 12H2O |
| ⓘ | Atacamite | 3.DA.10a | Cu2(OH)3Cl |
| ⓘ | Bismoclite ? | 3.DC.25 | BiOCl |
| ⓘ | Zavaritskite | 3.DC.25 | (BiO)F |
| Group 4 - Oxides and Hydroxides |
|---|
| ⓘ | Goethite | 4.00. | Fe3+O(OH) |
| ⓘ | 'Microlite Group' | 4.00. | A2-mTa2X6-wZ-n |
| ⓘ | Magnetite | 4.BB.05 | Fe2+Fe3+2O4 |
| ⓘ | Hematite | 4.CB.05 | Fe2O3 |
| ⓘ | Ilmenite | 4.CB.05 | Fe2+TiO3 |
| ⓘ | Pyrophanite | 4.CB.05 | Mn2+TiO3 |
| ⓘ | Quartz | 4.DA.05 | SiO2 |
| ⓘ | Opal | 4.DA.10 | SiO2 · nH2O |
| ⓘ | Cassiterite | 4.DB.05 | SnO2 |
| ⓘ | Rutile
var. Ilmenorutile | 4.DB.05 | (Ti,Nb)O2 |
| ⓘ | | 4.DB.05 | TiO2 |
| ⓘ | Samarskite-(Y) | 4.DB.25 | YFe3+Nb2O8 |
| ⓘ | Ferberite | 4.DB.30 | FeWO4 |
| ⓘ | Columbite-(Fe) | 4.DB.35 | Fe2+Nb2O6 |
| ⓘ | Tantalite-(Mn) | 4.DB.35 | Mn2+Ta2O6 |
| ⓘ | Anatase | 4.DD.05 | TiO2 |
| ⓘ | Brookite | 4.DD.10 | TiO2 |
| ⓘ | Russellite | 4.DE.15 | Bi2WO6 |
| ⓘ | Rynersonite | 4.DF.05 | CaTa2O6 |
| ⓘ | Vigezzite | 4.DF.05 | CaNb2O6 |
| ⓘ | Euxenite-(Y) | 4.DG.05 | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
| ⓘ | Fersmite | 4.DG.05 | CaNb2O6 |
| ⓘ | Uranopolycrase | 4.DG.05 | (U4+,Y)(Ti,Nb)2O6 |
| ⓘ | Petscheckite | 4.DH.35 | UFe(Nb,Ta)2O8 |
| ⓘ | Cryptomelane | 4.DK.05a | K(Mn4+7Mn3+)O16 |
| ⓘ | Cerianite-(Ce) | 4.DL.05 | (Ce4+,Th)O2 |
| ⓘ | Uraninite | 4.DL.05 | UO2 |
| ⓘ | Daubréeite ? | 4.F0.25 | BiO(OH) |
| ⓘ | Doyleite | 4.FE.10 | Al(OH)3 |
| ⓘ | Gibbsite | 4.FE.10 | Al(OH)3 |
| ⓘ | Metastudtite | 4.GA.15 | UO4 · 2H2O |
| ⓘ | Studtite | 4.GA.15 | [(UO2)(O2)(H2O)2] · H2O |
| ⓘ | Fourmarierite | 4.GB.25 | Pb(UO2)4O3(OH)4 · 4H2O |
| Group 5 - Nitrates and Carbonates |
|---|
| ⓘ | Calcite | 5.AB.05 | CaCO3 |
| ⓘ | Siderite | 5.AB.05 | FeCO3 |
| ⓘ | Cerussite | 5.AB.15 | PbCO3 |
| ⓘ | Azurite | 5.BA.05 | Cu3(CO3)2(OH)2 |
| ⓘ | Malachite | 5.BA.10 | Cu2(CO3)(OH)2 |
| ⓘ | Hydrozincite | 5.BA.15 | Zn5(CO3)2(OH)6 |
| ⓘ | Bastnäsite-(Ce) | 5.BD.20a | Ce(CO3)F |
| ⓘ | Bastnäsite-(Y) ? | 5.BD.20a | Y(CO3)F |
| ⓘ | Thorbastnäsite | 5.BD.20a | ThCa(CO3)2F2 · 3H2O |
| ⓘ | Bastnäsite-(Nd) | 5.BD.20a | Nd(CO3)F |
| ⓘ | Synchysite-(Nd) | 5.BD.20c | CaNd(CO3)2F |
| ⓘ | Synchysite-(Y) | 5.BD.20c | CaY(CO3)2F |
| ⓘ | Bismutite | 5.BE.25 | (BiO)2CO3 |
| ⓘ | Tengerite-(Y) | 5.CC.10 | Y2(CO3)3 · 2-3H2O |
| ⓘ | Lanthanite-(Ce) | 5.CC.25 | Ce2(CO3)3 · 8H2O |
| ⓘ | Calcioancylite-(Ce) | 5.DC.05 | (Ce,Ca,Sr)CO3(OH,H2O) |
| ⓘ | Schröckingerite | 5.EG.05 | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
| Group 7 - Sulphates, Chromates, Molybdates and Tungstates |
|---|
| ⓘ | Anglesite | 7.AD.35 | PbSO4 |
| ⓘ | Antlerite | 7.BB.15 | Cu3(SO4)(OH)4 |
| ⓘ | Brochantite | 7.BB.25 | Cu4(SO4)(OH)6 |
| ⓘ | Jarosite | 7.BC.10 | KFe3+3(SO4)2(OH)6 |
| ⓘ | Aplowite | 7.CB.15 | (Co,Mn,Ni)SO4 · 4H2O |
| ⓘ | Rozenite | 7.CB.15 | FeSO4 · 4H2O |
| ⓘ | Melanterite | 7.CB.35 | Fe2+(H2O)6SO4 · H2O |
| ⓘ | Gypsum | 7.CD.40 | CaSO4 · 2H2O |
| ⓘ | Fergusonite-(Y) | 7.GA.05 | YNbO4 |
| ⓘ | Scheelite | 7.GA.05 | Ca(WO4) |
| ⓘ | Wulfenite | 7.GA.05 | Pb(MoO4) |
| Group 8 - Phosphates, Arsenates and Vanadates |
|---|
| ⓘ | Xenotime-(Y) | 8.AD.35 | Y(PO4) |
| ⓘ | Xenotime-(Yb) | 8.AD.35 | Yb(PO4) |
| ⓘ | Monazite-(Ce) | 8.AD.50 | Ce(PO4) |
| ⓘ | Segnitite | 8.BL.10 | PbFe3+3AsO4(AsO3OH)(OH)6 |
| ⓘ | Fluorapatite | 8.BN.05 | Ca5(PO4)3F |
| ⓘ | Mimetite | 8.BN.05 | Pb5(AsO4)3Cl |
| ⓘ | Svabite | 8.BN.05 | Ca5(AsO4)3F |
| ⓘ | Scorodite | 8.CD.10 | Fe3+AsO4 · 2H2O |
| ⓘ | Richelsdorfite | 8.DK. | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
| ⓘ | Pharmacosiderite | 8.DK.10 | KFe3+4(AsO4)3(OH)4 · 6-7H2O |
| ⓘ | Agardite-(Y) | 8.DL.15 | YCu6(AsO4)3(OH)6 · 3H2O |
| ⓘ | Betpakdalite-CaCa | 8.DM.15 | [Ca2(H2O)17Ca(H2O)6][Mo6+8As5+2Fe3+3O36(OH)] |
| Group 9 - Silicates |
|---|
| ⓘ | Cayalsite-(Y) (TL) | 9.A0.05 | CaY6Al2Si4O18F6 |
| ⓘ | Phenakite | 9.AA.05 | Be2SiO4 |
| ⓘ | Almandine | 9.AD.25 | Fe2+3Al2(SiO4)3 |
| ⓘ | Spessartine | 9.AD.25 | Mn2+3Al2(SiO4)3 |
| ⓘ | Zircon
var. Alvite | 9.AD.30 | Zr(SiO4) |
| ⓘ | Thorite | 9.AD.30 | Th(SiO4) |
| ⓘ | Zircon | 9.AD.30 | Zr(SiO4) |
| ⓘ | Kyanite | 9.AF.15 | Al2(SiO4)O |
| ⓘ | Staurolite | 9.AF.30 | Fe2+2Al9Si4O23(OH) |
| ⓘ | Topaz | 9.AF.35 | Al2(SiO4)(F,OH)2 |
| ⓘ | Titanite | 9.AG.15 | CaTi(SiO4)O |
| ⓘ | Cerite-(CeCa) ? | 9.AG.20 | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
| ⓘ | Aluminocerite-(CeCa) | 9.AG.20 | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
| ⓘ | Törnebohmite-(Ce) | 9.AG.45 | Ce2Al(SiO4)2(OH) |
| ⓘ | Iimoriite-(Y) | 9.AH.05 | Y2[SiO4][CO3] |
| ⓘ | Britholite-(Y) | 9.AH.25 | (Y,Ca)5(SiO4)3OH |
| ⓘ | Fluorcalciobritholite | 9.AH.25 | (Ca,REE)5(SiO4,PO4)3F |
| ⓘ | Fluorbritholite-(Y) (TL) | 9.AH.25 | (Y,Ca)5(SiO4)3F |
| ⓘ | Gadolinite-(Y) | 9.AJ.20 | Y2Fe2+Be2Si2O10 |
| ⓘ | Hingganite-(Ce) | 9.AJ.20 | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
| ⓘ | Okanoganite-(Y) ? | 9.AJ.35 | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
| ⓘ | Hundholmenite-(Y) | 9.AJ.35 | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
| ⓘ | Parauranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Uranophane | 9.AK.15 | Ca(UO2)2(SiO3OH)2 · 5H2O |
| ⓘ | Keiviite-(Y) | 9.BC.05 | Y2Si2O7 |
| ⓘ | Bertrandite | 9.BD.05 | Be4(Si2O7)(OH)2 |
| ⓘ | Epidote | 9.BG.05a | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
| ⓘ | Piemontite | 9.BG.05a | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
| ⓘ | Allanite-(Ce) | 9.BG.05b | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Ferriallanite-(Ce) | 9.BG.05b | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
| ⓘ | Vyuntspakhkite-(Y) | 9.BG.40 | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
| ⓘ | Perbøeite-(Ce) (TL) | 9.BG.50 | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
| ⓘ | Thalénite-(Y) | 9.BJ.20 | Y3Si3O10F |
| ⓘ | Kainosite-(Y) | 9.CF.10 | Ca2Y2(SiO3)4(CO3) · H2O |
| ⓘ | Beryl
var. Aquamarine | 9.CJ.05 | Be3Al2Si6O18 |
| ⓘ | | 9.CJ.05 | Be3Al2(Si6O18) |
| ⓘ | Dravite | 9.CK.05 | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Schorl | 9.CK.05 | NaFe2+3Al6(Si6O18)(BO3)3(OH)3(OH) |
| ⓘ | Milarite | 9.CM.05 | K(◻H2O)Ca2(Be2Al)[Si12O30] |
| ⓘ | Bohseite | 9.DF. | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
| ⓘ | Bavenite ? | 9.DF.25 | Ca4Be2Al2Si9O26(OH)2 |
| ⓘ | Wollastonite | 9.DG.05 | Ca3(Si3O9) |
| ⓘ | Babingtonite | 9.DK.05 | Ca2Fe2+Fe3+Si5O14(OH) |
| ⓘ | Hellandite-(Y) | 9.DK.20 | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
| ⓘ | Talc | 9.EC.05 | Mg3Si4O10(OH)2 |
| ⓘ | Muscovite | 9.EC.15 | KAl2(AlSi3O10)(OH)2 |
| ⓘ | Annite | 9.EC.20 | KFe2+3(AlSi3O10)(OH)2 |
| ⓘ | Chamosite | 9.EC.55 | Fe2+5Al(AlSi3O)10(OH)8 |
| ⓘ | Cookeite | 9.EC.55 | (LiAl4◻)[AlSi3O10](OH)8 |
| ⓘ | Kaolinite | 9.ED.05 | Al2(Si2O5)(OH)4 |
| ⓘ | Halloysite | 9.ED.10 | Al2Si2O5(OH)4 · n(H2O) |
| ⓘ | Hisingerite | 9.ED.10 | Fe3+2(Si2O5)(OH)4 · 2H2O |
| ⓘ | Microcline
var. Amazonite | 9.FA.30 | K(AlSi3O8) |
| ⓘ | | 9.FA.30 | K(AlSi3O8) |
| ⓘ | Albite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | var. Cleavelandite | 9.FA.35 | Na(AlSi3O8) |
| ⓘ | Danalite | 9.FB.10 | Be3Fe2+4(SiO4)3S |
| ⓘ | Genthelvite | 9.FB.10 | Be3Zn4(SiO4)3S |
| ⓘ | Chabazite-Ca | 9.GD.10 | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
| ⓘ | Stilbite-Ca | 9.GE.10 | NaCa4(Si27Al9)O72 · 28H2O |
| ⓘ | Rowlandite-(Y) | 9.HG.20 | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
| Unclassified |
|---|
| ⓘ | 'Amphibole Supergroup' | - | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
| ⓘ | 'Apophyllite Group' | - | AB4[Si8O20]X · 8H2O |
| ⓘ | 'Bastnäsite' | - | (Ce/Nd/Y/REE)(CO3)F |
| ⓘ | 'Biotite' | - | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
| ⓘ | 'Chlorite Group' | - | |
| ⓘ | 'Feldspar Group' | - | |
| ⓘ | 'Stilbite Subgroup' | - | M6-7[Al8-9Si27-28O72] · nH2O |
| ⓘ | 'Tapiolite' | - | (Fe,Mn)(Ta,Nb)2O6 |
| ⓘ | 'Columbite-(Fe)-Columbite-(Mn) Series' | - | |
| ⓘ | 'Plagioclase' | - | (Na,Ca)[(Si,Al)AlSi2]O8 |
| ⓘ | 'K Feldspar' | - | |
| ⓘ | 'Garnet Group' | - | X3Z2(SiO4)3 |
| ⓘ | 'Bavenite-Bohseite Series' | - | |
| ⓘ | 'Allanite Group' | - | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
| ⓘ | 'Cayalsite-(Y)-1O' | - | CaY6Al2Si4O18F6 |
| ⓘ | 'Euxenite Group' | - | |
List of minerals for each chemical element
|
H | Hydrogen |
|---|
| H | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
|---|
| H | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| H | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| H | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
|---|
| H | ⓘ Antlerite | Cu3(SO4)(OH)4 |
|---|
| H | ⓘ Aplowite | (Co,Mn,Ni)SO4 · 4H2O |
|---|
| H | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
|---|
| H | ⓘ Atacamite | Cu2(OH)3Cl |
|---|
| H | ⓘ Azurite | Cu3(CO3)2(OH)2 |
|---|
| H | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
|---|
| H | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
|---|
| H | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
|---|
| H | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
|---|
| H | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| H | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
|---|
| H | ⓘ Brochantite | Cu4(SO4)(OH)6 |
|---|
| H | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
|---|
| H | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
|---|
| H | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
|---|
| H | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| H | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
|---|
| H | ⓘ Daubréeite | BiO(OH) |
|---|
| H | ⓘ Doyleite | Al(OH)3 |
|---|
| H | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| H | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
|---|
| H | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
|---|
| H | ⓘ Gibbsite | Al(OH)3 |
|---|
| H | ⓘ Goethite | Fe3+O(OH) |
|---|
| H | ⓘ Gypsum | CaSO4 · 2H2O |
|---|
| H | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
|---|
| H | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| H | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
|---|
| H | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
|---|
| H | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
|---|
| H | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
|---|
| H | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
|---|
| H | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
|---|
| H | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
|---|
| H | ⓘ Malachite | Cu2(CO3)(OH)2 |
|---|
| H | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
|---|
| H | ⓘ Metastudtite | UO4 · 2H2O |
|---|
| H | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| H | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
|---|
| H | ⓘ Opal | SiO2 · nH2O |
|---|
| H | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
|---|
| H | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
|---|
| H | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
| H | ⓘ Rozenite | FeSO4 · 4H2O |
|---|
| H | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| H | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| H | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
|---|
| H | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
|---|
| H | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
|---|
| H | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
|---|
| H | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
|---|
| H | ⓘ Talc | Mg3Si4O10(OH)2 |
|---|
| H | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
|---|
| H | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
|---|
| H | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
|---|
| H | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
|---|
| H | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| H | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| H | ⓘ Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
|---|
| H | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
| H | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
|---|
| H | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| H | ⓘ Aluminocerite-(CeCa) | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
|---|
| H | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
|---|
| H | ⓘ Bavenite-Bohseite Series | |
|---|
| H | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
| H | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
|---|
|
Li | Lithium |
|---|
| Li | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
|---|
|
Be | Beryllium |
|---|
| Be | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
|---|
| Be | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
|---|
| Be | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
|---|
| Be | ⓘ Beryl | Be3Al2(Si6O18) |
|---|
| Be | ⓘ Danalite | Be3Fe42+(SiO4)3S |
|---|
| Be | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
|---|
| Be | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
|---|
| Be | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
|---|
| Be | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| Be | ⓘ Phenakite | Be2SiO4 |
|---|
| Be | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
|---|
| Be | ⓘ Bavenite-Bohseite Series | |
|---|
|
B | Boron |
|---|
| B | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| B | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| B | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| B | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| B | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
|
C | Carbon |
|---|
| C | ⓘ Azurite | Cu3(CO3)2(OH)2 |
|---|
| C | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
|---|
| C | ⓘ Bastnäsite-(Y) | Y(CO3)F |
|---|
| C | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
|---|
| C | ⓘ Bismutite | (BiO)2CO3 |
|---|
| C | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
|---|
| C | ⓘ Calcite | CaCO3 |
|---|
| C | ⓘ Cerussite | PbCO3 |
|---|
| C | ⓘ Graphite | C |
|---|
| C | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
|---|
| C | ⓘ Iimoriite-(Y) | Y2[SiO4][CO3] |
|---|
| C | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
|---|
| C | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
|---|
| C | ⓘ Malachite | Cu2(CO3)(OH)2 |
|---|
| C | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| C | ⓘ Siderite | FeCO3 |
|---|
| C | ⓘ Synchysite-(Nd) | CaNd(CO3)2F |
|---|
| C | ⓘ Synchysite-(Y) | CaY(CO3)2F |
|---|
| C | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
|---|
| C | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
|---|
| C | ⓘ Bastnäsite-(Nd) | Nd(CO3)F |
|---|
|
O | Oxygen |
|---|
| O | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
|---|
| O | ⓘ Albite | Na(AlSi3O8) |
|---|
| O | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| O | ⓘ Zircon var. Alvite | Zr(SiO4) |
|---|
| O | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
|---|
| O | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| O | ⓘ Anatase | TiO2 |
|---|
| O | ⓘ Anglesite | PbSO4 |
|---|
| O | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
|---|
| O | ⓘ Antlerite | Cu3(SO4)(OH)4 |
|---|
| O | ⓘ Aplowite | (Co,Mn,Ni)SO4 · 4H2O |
|---|
| O | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
|---|
| O | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
|---|
| O | ⓘ Atacamite | Cu2(OH)3Cl |
|---|
| O | ⓘ Azurite | Cu3(CO3)2(OH)2 |
|---|
| O | ⓘ Almandine | Fe32+Al2(SiO4)3 |
|---|
| O | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
|---|
| O | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
|---|
| O | ⓘ Bastnäsite-(Y) | Y(CO3)F |
|---|
| O | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
|---|
| O | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
|---|
| O | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
|---|
| O | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
|---|
| O | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| O | ⓘ Bismoclite | BiOCl |
|---|
| O | ⓘ Bismutite | (BiO)2CO3 |
|---|
| O | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
|---|
| O | ⓘ Brochantite | Cu4(SO4)(OH)6 |
|---|
| O | ⓘ Brookite | TiO2 |
|---|
| O | ⓘ Beryl | Be3Al2(Si6O18) |
|---|
| O | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
|---|
| O | ⓘ Calcite | CaCO3 |
|---|
| O | ⓘ Cassiterite | SnO2 |
|---|
| O | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
|---|
| O | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
|---|
| O | ⓘ Cerussite | PbCO3 |
|---|
| O | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
|---|
| O | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| O | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
|---|
| O | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
|---|
| O | ⓘ Daubréeite | BiO(OH) |
|---|
| O | ⓘ Doyleite | Al(OH)3 |
|---|
| O | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| O | ⓘ Danalite | Be3Fe42+(SiO4)3S |
|---|
| O | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
|---|
| O | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| O | ⓘ Ferberite | FeWO4 |
|---|
| O | ⓘ Fergusonite-(Y) | YNbO4 |
|---|
| O | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
|---|
| O | ⓘ Fersmite | CaNb2O6 |
|---|
| O | ⓘ Fluorapatite | Ca5(PO4)3F |
|---|
| O | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
|---|
| O | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
|---|
| O | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
|---|
| O | ⓘ Gibbsite | Al(OH)3 |
|---|
| O | ⓘ Goethite | Fe3+O(OH) |
|---|
| O | ⓘ Gypsum | CaSO4 · 2H2O |
|---|
| O | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
|---|
| O | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| O | ⓘ Hematite | Fe2O3 |
|---|
| O | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
|---|
| O | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
|---|
| O | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
|---|
| O | ⓘ Iimoriite-(Y) | Y2[SiO4][CO3] |
|---|
| O | ⓘ Ilmenite | Fe2+TiO3 |
|---|
| O | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
|---|
| O | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
|---|
| O | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
|---|
| O | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
|---|
| O | ⓘ Keiviite-(Y) | Y2Si2O7 |
|---|
| O | ⓘ Kyanite | Al2(SiO4)O |
|---|
| O | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
|---|
| O | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
|---|
| O | ⓘ Magnetite | Fe2+Fe23+O4 |
|---|
| O | ⓘ Malachite | Cu2(CO3)(OH)2 |
|---|
| O | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
|---|
| O | ⓘ Metastudtite | UO4 · 2H2O |
|---|
| O | ⓘ Microcline | K(AlSi3O8) |
|---|
| O | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| O | ⓘ Mimetite | Pb5(AsO4)3Cl |
|---|
| O | ⓘ Monazite-(Ce) | Ce(PO4) |
|---|
| O | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
|---|
| O | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| O | ⓘ Opal | SiO2 · nH2O |
|---|
| O | ⓘ Petscheckite | UFe(Nb,Ta)2O8 |
|---|
| O | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
|---|
| O | ⓘ Phenakite | Be2SiO4 |
|---|
| O | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
|---|
| O | ⓘ Pyrophanite | Mn2+TiO3 |
|---|
| O | ⓘ Quartz | SiO2 |
|---|
| O | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
| O | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
|---|
| O | ⓘ Rozenite | FeSO4 · 4H2O |
|---|
| O | ⓘ Russellite | Bi2WO6 |
|---|
| O | ⓘ Rutile | TiO2 |
|---|
| O | ⓘ Rynersonite | CaTa2O6 |
|---|
| O | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
|---|
| O | ⓘ Scheelite | Ca(WO4) |
|---|
| O | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| O | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| O | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
|---|
| O | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
|---|
| O | ⓘ Siderite | FeCO3 |
|---|
| O | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
|---|
| O | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
|---|
| O | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
|---|
| O | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
|---|
| O | ⓘ Svabite | Ca5(AsO4)3F |
|---|
| O | ⓘ Synchysite-(Nd) | CaNd(CO3)2F |
|---|
| O | ⓘ Synchysite-(Y) | CaY(CO3)2F |
|---|
| O | ⓘ Talc | Mg3Si4O10(OH)2 |
|---|
| O | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
|---|
| O | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
|---|
| O | ⓘ Thalénite-(Y) | Y3Si3O10F |
|---|
| O | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
|---|
| O | ⓘ Thorite | Th(SiO4) |
|---|
| O | ⓘ Titanite | CaTi(SiO4)O |
|---|
| O | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
|---|
| O | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
|---|
| O | ⓘ Uraninite | UO2 |
|---|
| O | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| O | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| O | ⓘ Uranopolycrase | (U4+,Y)(Ti,Nb)2O6 |
|---|
| O | ⓘ Vigezzite | CaNb2O6 |
|---|
| O | ⓘ Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
|---|
| O | ⓘ Wulfenite | Pb(MoO4) |
|---|
| O | ⓘ Wollastonite | Ca3(Si3O9) |
|---|
| O | ⓘ Xenotime-(Y) | Y(PO4) |
|---|
| O | ⓘ Zavaritskite | (BiO)F |
|---|
| O | ⓘ Zircon | Zr(SiO4) |
|---|
| O | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
| O | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
|---|
| O | ⓘ Xenotime-(Yb) | Yb(PO4) |
|---|
| O | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
|---|
| O | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
|---|
| O | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
|---|
| O | ⓘ Garnet Group | X3Z2(SiO4)3 |
|---|
| O | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| O | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| O | ⓘ Bastnäsite-(Nd) | Nd(CO3)F |
|---|
| O | ⓘ Fluorcalciobritholite | (Ca,REE)5(SiO4,PO4)3F |
|---|
| O | ⓘ Aluminocerite-(CeCa) | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
|---|
| O | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
|---|
| O | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
|---|
| O | ⓘ Bavenite-Bohseite Series | |
|---|
| O | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
| O | ⓘ Cayalsite-(Y) | CaY6Al2Si4O18F6 |
|---|
| O | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
|---|
| O | ⓘ Cayalsite-(Y)-1O | CaY6Al2Si4O18F6 |
|---|
|
F | Fluorine |
|---|
| F | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| F | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
|---|
| F | ⓘ Bastnäsite-(Y) | Y(CO3)F |
|---|
| F | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
|---|
| F | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| F | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| F | ⓘ Fluocerite-(Ce) | CeF3 |
|---|
| F | ⓘ Fluorapatite | Ca5(PO4)3F |
|---|
| F | ⓘ Fluorite | CaF2 |
|---|
| F | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| F | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
|---|
| F | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| F | ⓘ Svabite | Ca5(AsO4)3F |
|---|
| F | ⓘ Synchysite-(Nd) | CaNd(CO3)2F |
|---|
| F | ⓘ Synchysite-(Y) | CaY(CO3)2F |
|---|
| F | ⓘ Thalénite-(Y) | Y3Si3O10F |
|---|
| F | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
|---|
| F | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
|---|
| F | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
|---|
| F | ⓘ Zavaritskite | (BiO)F |
|---|
| F | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| F | ⓘ Bastnäsite-(Nd) | Nd(CO3)F |
|---|
| F | ⓘ Fluorcalciobritholite | (Ca,REE)5(SiO4,PO4)3F |
|---|
| F | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
|---|
| F | ⓘ Cayalsite-(Y) | CaY6Al2Si4O18F6 |
|---|
| F | ⓘ Cayalsite-(Y)-1O | CaY6Al2Si4O18F6 |
|---|
|
Na | Sodium |
|---|
| Na | ⓘ Albite | Na(AlSi3O8) |
|---|
| Na | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Na | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| Na | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Na | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| Na | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
| Na | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
|---|
| Na | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
|---|
| Na | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
|---|
| Na | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
|
Mg | Magnesium |
|---|
| Mg | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| Mg | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
|---|
| Mg | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Mg | ⓘ Talc | Mg3Si4O10(OH)2 |
|---|
|
Al | Aluminium |
|---|
| Al | ⓘ Albite | Na(AlSi3O8) |
|---|
| Al | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Al | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
|---|
| Al | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| Al | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
|---|
| Al | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
|---|
| Al | ⓘ Almandine | Fe32+Al2(SiO4)3 |
|---|
| Al | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
|---|
| Al | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| Al | ⓘ Beryl | Be3Al2(Si6O18) |
|---|
| Al | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
|---|
| Al | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| Al | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
|---|
| Al | ⓘ Doyleite | Al(OH)3 |
|---|
| Al | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Al | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
|---|
| Al | ⓘ Gibbsite | Al(OH)3 |
|---|
| Al | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
|---|
| Al | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| Al | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
|---|
| Al | ⓘ Kyanite | Al2(SiO4)O |
|---|
| Al | ⓘ Microcline | K(AlSi3O8) |
|---|
| Al | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| Al | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
|---|
| Al | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
|---|
| Al | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Al | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
|---|
| Al | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
|---|
| Al | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
|---|
| Al | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
|---|
| Al | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
|---|
| Al | ⓘ Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
|---|
| Al | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
| Al | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
|---|
| Al | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
|---|
| Al | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
|---|
| Al | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Al | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| Al | ⓘ Aluminocerite-(CeCa) | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
|---|
| Al | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
|---|
| Al | ⓘ Bavenite-Bohseite Series | |
|---|
| Al | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
| Al | ⓘ Cayalsite-(Y) | CaY6Al2Si4O18F6 |
|---|
| Al | ⓘ Cayalsite-(Y)-1O | CaY6Al2Si4O18F6 |
|---|
|
Si | Silicon |
|---|
| Si | ⓘ Albite | Na(AlSi3O8) |
|---|
| Si | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Si | ⓘ Zircon var. Alvite | Zr(SiO4) |
|---|
| Si | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
|---|
| Si | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| Si | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
|---|
| Si | ⓘ Apophyllite Group | AB4[Si8O20]X · 8H2O |
|---|
| Si | ⓘ Beryl var. Aquamarine | Be3Al2Si6O18 |
|---|
| Si | ⓘ Almandine | Fe32+Al2(SiO4)3 |
|---|
| Si | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
|---|
| Si | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
|---|
| Si | ⓘ Bertrandite | Be4(Si2O7)(OH)2 |
|---|
| Si | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| Si | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
|---|
| Si | ⓘ Beryl | Be3Al2(Si6O18) |
|---|
| Si | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
|---|
| Si | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
|---|
| Si | ⓘ Cookeite | (LiAl4◻)[AlSi3O10](OH)8 |
|---|
| Si | ⓘ Dravite | NaMg3Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Si | ⓘ Danalite | Be3Fe42+(SiO4)3S |
|---|
| Si | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
|---|
| Si | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
|---|
| Si | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
|---|
| Si | ⓘ Halloysite | Al2Si2O5(OH)4 · n(H2O) |
|---|
| Si | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| Si | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
|---|
| Si | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
|---|
| Si | ⓘ Iimoriite-(Y) | Y2[SiO4][CO3] |
|---|
| Si | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
|---|
| Si | ⓘ Kaolinite | Al2(Si2O5)(OH)4 |
|---|
| Si | ⓘ Keiviite-(Y) | Y2Si2O7 |
|---|
| Si | ⓘ Kyanite | Al2(SiO4)O |
|---|
| Si | ⓘ Microcline | K(AlSi3O8) |
|---|
| Si | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| Si | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
|---|
| Si | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| Si | ⓘ Opal | SiO2 · nH2O |
|---|
| Si | ⓘ Phenakite | Be2SiO4 |
|---|
| Si | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
|---|
| Si | ⓘ Quartz | SiO2 |
|---|
| Si | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
|---|
| Si | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Si | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
|---|
| Si | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
|---|
| Si | ⓘ Stilbite Subgroup | M6-7[Al8-9Si27-28O72] · nH2O |
|---|
| Si | ⓘ Talc | Mg3Si4O10(OH)2 |
|---|
| Si | ⓘ Thalénite-(Y) | Y3Si3O10F |
|---|
| Si | ⓘ Thorite | Th(SiO4) |
|---|
| Si | ⓘ Titanite | CaTi(SiO4)O |
|---|
| Si | ⓘ Topaz | Al2(SiO4)(F,OH)2 |
|---|
| Si | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
|---|
| Si | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| Si | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| Si | ⓘ Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
|---|
| Si | ⓘ Wollastonite | Ca3(Si3O9) |
|---|
| Si | ⓘ Zircon | Zr(SiO4) |
|---|
| Si | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
| Si | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
|---|
| Si | ⓘ Albite var. Cleavelandite | Na(AlSi3O8) |
|---|
| Si | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
|---|
| Si | ⓘ Garnet Group | X3Z2(SiO4)3 |
|---|
| Si | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Si | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| Si | ⓘ Fluorcalciobritholite | (Ca,REE)5(SiO4,PO4)3F |
|---|
| Si | ⓘ Aluminocerite-(CeCa) | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
|---|
| Si | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
|---|
| Si | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
|---|
| Si | ⓘ Bavenite-Bohseite Series | |
|---|
| Si | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
| Si | ⓘ Cayalsite-(Y) | CaY6Al2Si4O18F6 |
|---|
| Si | ⓘ Allanite Group | (A12+REE3+)(M13+M23+M32+)O[Si2O7][SiO4](OH) |
|---|
| Si | ⓘ Cayalsite-(Y)-1O | CaY6Al2Si4O18F6 |
|---|
|
P | Phosphorus |
|---|
| P | ⓘ Fluorapatite | Ca5(PO4)3F |
|---|
| P | ⓘ Monazite-(Ce) | Ce(PO4) |
|---|
| P | ⓘ Xenotime-(Y) | Y(PO4) |
|---|
| P | ⓘ Xenotime-(Yb) | Yb(PO4) |
|---|
| P | ⓘ Fluorcalciobritholite | (Ca,REE)5(SiO4,PO4)3F |
|---|
|
S | Sulfur |
|---|
| S | ⓘ Anglesite | PbSO4 |
|---|
| S | ⓘ Antlerite | Cu3(SO4)(OH)4 |
|---|
| S | ⓘ Aplowite | (Co,Mn,Ni)SO4 · 4H2O |
|---|
| S | ⓘ Arsenopyrite | FeAsS |
|---|
| S | ⓘ Bornite | Cu5FeS4 |
|---|
| S | ⓘ Brochantite | Cu4(SO4)(OH)6 |
|---|
| S | ⓘ Chalcopyrite | CuFeS2 |
|---|
| S | ⓘ Chalcocite | Cu2S |
|---|
| S | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| S | ⓘ Djurleite | Cu31S16 |
|---|
| S | ⓘ Danalite | Be3Fe42+(SiO4)3S |
|---|
| S | ⓘ Galena | PbS |
|---|
| S | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
|---|
| S | ⓘ Gypsum | CaSO4 · 2H2O |
|---|
| S | ⓘ Idaite | Cu5FeS6 |
|---|
| S | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
|---|
| S | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
|---|
| S | ⓘ Molybdenite | MoS2 |
|---|
| S | ⓘ Pyrite | FeS2 |
|---|
| S | ⓘ Pyrrhotite | Fe1-xS |
|---|
| S | ⓘ Rozenite | FeSO4 · 4H2O |
|---|
| S | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| S | ⓘ Sphalerite | ZnS |
|---|
| S | ⓘ Native Sulphur | S8 |
|---|
| S | ⓘ Tungstenite | WS2 |
|---|
| S | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
|---|
| S | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
|---|
|
Cl | Chlorine |
|---|
| Cl | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| Cl | ⓘ Atacamite | Cu2(OH)3Cl |
|---|
| Cl | ⓘ Bismoclite | BiOCl |
|---|
| Cl | ⓘ Mimetite | Pb5(AsO4)3Cl |
|---|
| Cl | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
|
K | Potassium |
|---|
| K | ⓘ Microcline var. Amazonite | K(AlSi3O8) |
|---|
| K | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
|---|
| K | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| K | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
|---|
| K | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
|---|
| K | ⓘ Microcline | K(AlSi3O8) |
|---|
| K | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| K | ⓘ Muscovite | KAl2(AlSi3O10)(OH)2 |
|---|
| K | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
|---|
| K | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
|
Ca | Calcium |
|---|
| Ca | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Ca | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
|---|
| Ca | ⓘ Bavenite | Ca4Be2Al2Si9O26(OH)2 |
|---|
| Ca | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
|---|
| Ca | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
|---|
| Ca | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
|---|
| Ca | ⓘ Calcite | CaCO3 |
|---|
| Ca | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
|---|
| Ca | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| Ca | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
|---|
| Ca | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Ca | ⓘ Fersmite | CaNb2O6 |
|---|
| Ca | ⓘ Fluorapatite | Ca5(PO4)3F |
|---|
| Ca | ⓘ Fluorite | CaF2 |
|---|
| Ca | ⓘ Gypsum | CaSO4 · 2H2O |
|---|
| Ca | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| Ca | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
|---|
| Ca | ⓘ Milarite | K(◻H2O)Ca2(Be2Al)[Si12O30] |
|---|
| Ca | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| Ca | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
|---|
| Ca | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
| Ca | ⓘ Rynersonite | CaTa2O6 |
|---|
| Ca | ⓘ Scheelite | Ca(WO4) |
|---|
| Ca | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| Ca | ⓘ Svabite | Ca5(AsO4)3F |
|---|
| Ca | ⓘ Synchysite-(Nd) | CaNd(CO3)2F |
|---|
| Ca | ⓘ Synchysite-(Y) | CaY(CO3)2F |
|---|
| Ca | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
|---|
| Ca | ⓘ Titanite | CaTi(SiO4)O |
|---|
| Ca | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| Ca | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| Ca | ⓘ Vigezzite | CaNb2O6 |
|---|
| Ca | ⓘ Wollastonite | Ca3(Si3O9) |
|---|
| Ca | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
|---|
| Ca | ⓘ Chabazite-Ca | (Ca,K2,Na2)2[Al2Si4O12]2 · 12H2O |
|---|
| Ca | ⓘ Stilbite-Ca | NaCa4(Si27Al9)O72 · 28H2O |
|---|
| Ca | ⓘ Plagioclase | (Na,Ca)[(Si,Al)AlSi2]O8 |
|---|
| Ca | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Ca | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| Ca | ⓘ Fluorcalciobritholite | (Ca,REE)5(SiO4,PO4)3F |
|---|
| Ca | ⓘ Aluminocerite-(CeCa) | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
|---|
| Ca | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
|---|
| Ca | ⓘ Bohseite | Ca4Be3+xAl1-xSi9O25-x(OH)3+x |
|---|
| Ca | ⓘ Bavenite-Bohseite Series | |
|---|
| Ca | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
| Ca | ⓘ Cayalsite-(Y) | CaY6Al2Si4O18F6 |
|---|
| Ca | ⓘ Cayalsite-(Y)-1O | CaY6Al2Si4O18F6 |
|---|
|
Ti | Titanium |
|---|
| Ti | ⓘ Amphibole Supergroup | AB2C5((Si,Al,Ti)8O22)(OH,F,Cl,O)2 |
|---|
| Ti | ⓘ Anatase | TiO2 |
|---|
| Ti | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| Ti | ⓘ Brookite | TiO2 |
|---|
| Ti | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Ti | ⓘ Ilmenite | Fe2+TiO3 |
|---|
| Ti | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
|---|
| Ti | ⓘ Pyrophanite | Mn2+TiO3 |
|---|
| Ti | ⓘ Rutile | TiO2 |
|---|
| Ti | ⓘ Titanite | CaTi(SiO4)O |
|---|
| Ti | ⓘ Uranopolycrase | (U4+,Y)(Ti,Nb)2O6 |
|---|
|
Mn | Manganese |
|---|
| Mn | ⓘ Aplowite | (Co,Mn,Ni)SO4 · 4H2O |
|---|
| Mn | ⓘ Cryptomelane | K(Mn74+Mn3+)O16 |
|---|
| Mn | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
|---|
| Mn | ⓘ Piemontite | (CaCa)(AlAlMn3+)O[Si2O7][SiO4](OH) |
|---|
| Mn | ⓘ Pyrophanite | Mn2+TiO3 |
|---|
| Mn | ⓘ Spessartine | Mn32+Al2(SiO4)3 |
|---|
| Mn | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
|---|
| Mn | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
|---|
|
Fe | Iron |
|---|
| Fe | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Fe | ⓘ Annite | KFe32+(AlSi3O10)(OH)2 |
|---|
| Fe | ⓘ Arsenopyrite | FeAsS |
|---|
| Fe | ⓘ Almandine | Fe32+Al2(SiO4)3 |
|---|
| Fe | ⓘ Babingtonite | Ca2Fe2+Fe3+Si5O14(OH) |
|---|
| Fe | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
|---|
| Fe | ⓘ Biotite | K(Fe2+/Mg)2(Al/Fe3+/Mg/Ti)([Si/Al/Fe]2Si2O10)(OH/F)2 |
|---|
| Fe | ⓘ Bornite | Cu5FeS4 |
|---|
| Fe | ⓘ Chalcopyrite | CuFeS2 |
|---|
| Fe | ⓘ Chamosite | Fe52+Al(AlSi3O)10(OH)8 |
|---|
| Fe | ⓘ Danalite | Be3Fe42+(SiO4)3S |
|---|
| Fe | ⓘ Epidote | (CaCa)(AlAlFe3+)O[Si2O7][SiO4](OH) |
|---|
| Fe | ⓘ Ferberite | FeWO4 |
|---|
| Fe | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
|---|
| Fe | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
|---|
| Fe | ⓘ Goethite | Fe3+O(OH) |
|---|
| Fe | ⓘ Hematite | Fe2O3 |
|---|
| Fe | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
|---|
| Fe | ⓘ Hisingerite | Fe23+(Si2O5)(OH)4 · 2H2O |
|---|
| Fe | ⓘ Idaite | Cu5FeS6 |
|---|
| Fe | ⓘ Ilmenite | Fe2+TiO3 |
|---|
| Fe | ⓘ Jarosite | KFe33+(SO4)2(OH)6 |
|---|
| Fe | ⓘ Löllingite | FeAs2 |
|---|
| Fe | ⓘ Magnetite | Fe2+Fe23+O4 |
|---|
| Fe | ⓘ Melanterite | Fe2+(H2O)6SO4 · H2O |
|---|
| Fe | ⓘ Petscheckite | UFe(Nb,Ta)2O8 |
|---|
| Fe | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
|---|
| Fe | ⓘ Pyrite | FeS2 |
|---|
| Fe | ⓘ Pyrrhotite | Fe1-xS |
|---|
| Fe | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
|---|
| Fe | ⓘ Rozenite | FeSO4 · 4H2O |
|---|
| Fe | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
|---|
| Fe | ⓘ Schorl | NaFe32+Al6(Si6O18)(BO3)3(OH)3(OH) |
|---|
| Fe | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
|---|
| Fe | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
|---|
| Fe | ⓘ Siderite | FeCO3 |
|---|
| Fe | ⓘ Staurolite | Fe22+Al9Si4O23(OH) |
|---|
| Fe | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
|---|
| Fe | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
|---|
| Fe | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Fe | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| Fe | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
| Fe | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
|---|
|
Co | Cobalt |
|---|
| Co | ⓘ Aplowite | (Co,Mn,Ni)SO4 · 4H2O |
|---|
|
Ni | Nickel |
|---|
| Ni | ⓘ Aplowite | (Co,Mn,Ni)SO4 · 4H2O |
|---|
|
Cu | Copper |
|---|
| Cu | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
|---|
| Cu | ⓘ Antlerite | Cu3(SO4)(OH)4 |
|---|
| Cu | ⓘ Atacamite | Cu2(OH)3Cl |
|---|
| Cu | ⓘ Azurite | Cu3(CO3)2(OH)2 |
|---|
| Cu | ⓘ Bornite | Cu5FeS4 |
|---|
| Cu | ⓘ Brochantite | Cu4(SO4)(OH)6 |
|---|
| Cu | ⓘ Chalcopyrite | CuFeS2 |
|---|
| Cu | ⓘ Chalcocite | Cu2S |
|---|
| Cu | ⓘ Djurleite | Cu31S16 |
|---|
| Cu | ⓘ Idaite | Cu5FeS6 |
|---|
| Cu | ⓘ Malachite | Cu2(CO3)(OH)2 |
|---|
| Cu | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
| Cu | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
|---|
| Cu | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
|---|
|
Zn | Zinc |
|---|
| Zn | ⓘ Genthelvite | Be3Zn4(SiO4)3S |
|---|
| Zn | ⓘ Hydrozincite | Zn5(CO3)2(OH)6 |
|---|
| Zn | ⓘ Sphalerite | ZnS |
|---|
| Zn | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
|---|
|
As | Arsenic |
|---|
| As | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
|---|
| As | ⓘ Arsenopyrite | FeAsS |
|---|
| As | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
|---|
| As | ⓘ Löllingite | FeAs2 |
|---|
| As | ⓘ Mimetite | Pb5(AsO4)3Cl |
|---|
| As | ⓘ Pharmacosiderite | KFe43+(AsO4)3(OH)4 · 6-7H2O |
|---|
| As | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
| As | ⓘ Scorodite | Fe3+AsO4 · 2H2O |
|---|
| As | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
|---|
| As | ⓘ Svabite | Ca5(AsO4)3F |
|---|
| As | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| As | ⓘ Tennantite-(Zn) | Cu6(Cu4Zn2)As4S12S |
|---|
| As | ⓘ Tennantite-(Fe) | Cu6(Cu4Fe22+)As4S12S |
|---|
|
Se | Selenium |
|---|
| Se | ⓘ Naumannite | Ag2Se |
|---|
|
Sr | Strontium |
|---|
| Sr | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
|---|
|
Y | Yttrium |
|---|
| Y | ⓘ Agardite-(Y) | YCu6(AsO4)3(OH)6 · 3H2O |
|---|
| Y | ⓘ Bastnäsite-(Y) | Y(CO3)F |
|---|
| Y | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
|---|
| Y | ⓘ Britholite-(Y) | (Y,Ca)5(SiO4)3OH |
|---|
| Y | ⓘ Chukhrovite-(Y) | Ca3YAl2(SO4)F13 · 12H2O |
|---|
| Y | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Y | ⓘ Fergusonite-(Y) | YNbO4 |
|---|
| Y | ⓘ Gadolinite-(Y) | Y2Fe2+Be2Si2O10 |
|---|
| Y | ⓘ Hellandite-(Y) | (Ca,REE)4Y2Al◻2(B4Si4O22) (OH)2 |
|---|
| Y | ⓘ Iimoriite-(Y) | Y2[SiO4][CO3] |
|---|
| Y | ⓘ Kainosite-(Y) | Ca2Y2(SiO3)4(CO3) · H2O |
|---|
| Y | ⓘ Keiviite-(Y) | Y2Si2O7 |
|---|
| Y | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| Y | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
|---|
| Y | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
|---|
| Y | ⓘ Synchysite-(Y) | CaY(CO3)2F |
|---|
| Y | ⓘ Tengerite-(Y) | Y2(CO3)3 · 2-3H2O |
|---|
| Y | ⓘ Thalénite-(Y) | Y3Si3O10F |
|---|
| Y | ⓘ Uranopolycrase | (U4+,Y)(Ti,Nb)2O6 |
|---|
| Y | ⓘ Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
|---|
| Y | ⓘ Xenotime-(Y) | Y(PO4) |
|---|
| Y | ⓘ Fluorite var. Yttrofluorite | (Ca1-xYx)F2+x where 0.05 < x < 0.3 |
|---|
| Y | ⓘ Hundholmenite-(Y) | (Y,REE,Ca,Na)15(Al,Fe3+)(CaxAs3+1-x)(Si,As5+)Si6B3(O,F)48 |
|---|
| Y | ⓘ Fluorbritholite-(Y) | (Y,Ca)5(SiO4)3F |
|---|
| Y | ⓘ Cayalsite-(Y) | CaY6Al2Si4O18F6 |
|---|
| Y | ⓘ Cayalsite-(Y)-1O | CaY6Al2Si4O18F6 |
|---|
|
Zr | Zirconium |
|---|
| Zr | ⓘ Zircon var. Alvite | Zr(SiO4) |
|---|
| Zr | ⓘ Zircon | Zr(SiO4) |
|---|
|
Nb | Niobium |
|---|
| Nb | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Nb | ⓘ Fergusonite-(Y) | YNbO4 |
|---|
| Nb | ⓘ Columbite-(Fe) | Fe2+Nb2O6 |
|---|
| Nb | ⓘ Fersmite | CaNb2O6 |
|---|
| Nb | ⓘ Rutile var. Ilmenorutile | (Ti,Nb)O2 |
|---|
| Nb | ⓘ Petscheckite | UFe(Nb,Ta)2O8 |
|---|
| Nb | ⓘ Samarskite-(Y) | YFe3+Nb2O8 |
|---|
| Nb | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
|---|
| Nb | ⓘ Uranopolycrase | (U4+,Y)(Ti,Nb)2O6 |
|---|
| Nb | ⓘ Vigezzite | CaNb2O6 |
|---|
| Nb | ⓘ Columbite-(Fe)-Columbite-(Mn) Series | |
|---|
|
Mo | Molybdenum |
|---|
| Mo | ⓘ Betpakdalite-CaCa | [Ca2(H2O)17Ca(H2O)6][Mo86+As25+Fe33+O36(OH)] |
|---|
| Mo | ⓘ Molybdenite | MoS2 |
|---|
| Mo | ⓘ Wulfenite | Pb(MoO4) |
|---|
|
Ag | Silver |
|---|
| Ag | ⓘ Hessite | Ag2Te |
|---|
| Ag | ⓘ Naumannite | Ag2Se |
|---|
|
Sn | Tin |
|---|
| Sn | ⓘ Cassiterite | SnO2 |
|---|
|
Sb | Antimony |
|---|
| Sb | ⓘ Richelsdorfite | Ca2Cu5Sb(AsO4)4(OH)6Cl · 6H2O |
|---|
|
Te | Tellurium |
|---|
| Te | ⓘ Hessite | Ag2Te |
|---|
|
Ce | Cerium |
|---|
| Ce | ⓘ Allanite-(Ce) | (CaCe)(AlAlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Ce | ⓘ Bastnäsite-(Ce) | Ce(CO3)F |
|---|
| Ce | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
|---|
| Ce | ⓘ Calcioancylite-(Ce) | (Ce,Ca,Sr)CO3(OH,H2O) |
|---|
| Ce | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
|---|
| Ce | ⓘ Cerite-(CeCa) | (Ce7Ca2)◻Mg(SiO4)3(SiO3OH)4(OH)3 |
|---|
| Ce | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Ce | ⓘ Fluocerite-(Ce) | CeF3 |
|---|
| Ce | ⓘ Hingganite-(Ce) | (Ce,REE)2(◻,Fe2+)Be2[SiO4]2(OH)2 |
|---|
| Ce | ⓘ Lanthanite-(Ce) | Ce2(CO3)3 · 8H2O |
|---|
| Ce | ⓘ Monazite-(Ce) | Ce(PO4) |
|---|
| Ce | ⓘ Okanoganite-(Y) | (Na,Ca)3(Y,Ce)12Si6B2O27F14 |
|---|
| Ce | ⓘ Rowlandite-(Y) | (Y,Ce)4Fe2+(Si2O7)2F2 (?) |
|---|
| Ce | ⓘ Törnebohmite-(Ce) | Ce2Al(SiO4)2(OH) |
|---|
| Ce | ⓘ Ferriallanite-(Ce) | (CaCe)(Fe3+AlFe2+)O[Si2O7][SiO4](OH) |
|---|
| Ce | ⓘ Aluminocerite-(CeCa) | (Ce6Ca3)◻Al(SiO4)3[SiO3(OH)]4(OH)3 |
|---|
| Ce | ⓘ Perbøeite-(Ce) | CaCe3(AlAl2Fe2+)[Si2O7][SiO4]3O(OH)2 |
|---|
|
Nd | Neodymium |
|---|
| Nd | ⓘ Bastnäsite | (Ce/Nd/Y/REE)(CO3)F |
|---|
| Nd | ⓘ Synchysite-(Nd) | CaNd(CO3)2F |
|---|
| Nd | ⓘ Bastnäsite-(Nd) | Nd(CO3)F |
|---|
|
Yb | Ytterbium |
|---|
| Yb | ⓘ Vyuntspakhkite-(Y) | (Y,Yb)4Al2.5-1.5(Si,Al)1.5-2.5(SiO4)4O(OH)7 |
|---|
| Yb | ⓘ Xenotime-(Yb) | Yb(PO4) |
|---|
|
Ta | Tantalum |
|---|
| Ta | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Ta | ⓘ Tantalite-(Mn) | Mn2+Ta2O6 |
|---|
| Ta | ⓘ Microlite Group | A2-mTa2X6-wZ-n |
|---|
| Ta | ⓘ Petscheckite | UFe(Nb,Ta)2O8 |
|---|
| Ta | ⓘ Rynersonite | CaTa2O6 |
|---|
| Ta | ⓘ Tapiolite | (Fe,Mn)(Ta,Nb)2O6 |
|---|
|
W | Tungsten |
|---|
| W | ⓘ Ferberite | FeWO4 |
|---|
| W | ⓘ Russellite | Bi2WO6 |
|---|
| W | ⓘ Scheelite | Ca(WO4) |
|---|
| W | ⓘ Tungstenite | WS2 |
|---|
|
Au | Gold |
|---|
| Au | ⓘ Native Gold | Au |
|---|
|
Pb | Lead |
|---|
| Pb | ⓘ Anglesite | PbSO4 |
|---|
| Pb | ⓘ Cerussite | PbCO3 |
|---|
| Pb | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
|---|
| Pb | ⓘ Galena | PbS |
|---|
| Pb | ⓘ Mimetite | Pb5(AsO4)3Cl |
|---|
| Pb | ⓘ Segnitite | PbFe33+AsO4(AsO3OH)(OH)6 |
|---|
| Pb | ⓘ Wulfenite | Pb(MoO4) |
|---|
|
Bi | Bismuth |
|---|
| Bi | ⓘ Bismoclite | BiOCl |
|---|
| Bi | ⓘ Native Bismuth | Bi |
|---|
| Bi | ⓘ Bismutite | (BiO)2CO3 |
|---|
| Bi | ⓘ Daubréeite | BiO(OH) |
|---|
| Bi | ⓘ Russellite | Bi2WO6 |
|---|
| Bi | ⓘ Zavaritskite | (BiO)F |
|---|
|
Th | Thorium |
|---|
| Th | ⓘ Cerianite-(Ce) | (Ce4+,Th)O2 |
|---|
| Th | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| Th | ⓘ Thorbastnäsite | ThCa(CO3)2F2 · 3H2O |
|---|
| Th | ⓘ Thorite | Th(SiO4) |
|---|
|
U | Uranium |
|---|
| U | ⓘ Euxenite-(Y) | (Y,Ca,Ce,U,Th)(Nb,Ta,Ti)2O6 |
|---|
| U | ⓘ Fourmarierite | Pb(UO2)4O3(OH)4 · 4H2O |
|---|
| U | ⓘ Metastudtite | UO4 · 2H2O |
|---|
| U | ⓘ Petscheckite | UFe(Nb,Ta)2O8 |
|---|
| U | ⓘ Schröckingerite | NaCa3(UO2)(CO3)3(SO4)F · 10H2O |
|---|
| U | ⓘ Studtite | [(UO2)(O2)(H2O)2] · H2O |
|---|
| U | ⓘ Uraninite | UO2 |
|---|
| U | ⓘ Parauranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| U | ⓘ Uranophane | Ca(UO2)2(SiO3OH)2 · 5H2O |
|---|
| U | ⓘ Uranopolycrase | (U4+,Y)(Ti,Nb)2O6 |
|---|
Geochronology
Mineralization age: Paleoproterozoic : 1772 Ma
Important note: This table is based only on rock and mineral ages recorded on mindat.org for this locality and is not necessarily a complete representation of the geochronology, but does give an indication of possible mineralization events relevant to this locality. As more age information is added this table may expand in the future. A break in the table simply indicates a lack of data entered here, not necessarily a break in the geologic sequence. Grey background entries are from different, related, localities.
Fossils
This region is too big or complex to display the fossil list, try looking at smaller subregions.Other Databases
Localities in this Region
Other Regions, Features and Areas that Intersect
This page contains all mineral locality references listed on mindat.org. This does not claim to be a complete list. If you know of more minerals from this site, please register so you can add to our database. This locality information is for reference purposes only. You should never attempt to
visit any sites listed in mindat.org without first ensuring that you have the permission of the land and/or mineral rights holders
for access and that you are aware of all safety precautions necessary. References
|
Håkonhals Quarry, Finnøya, Hamarøy, Nordland, Norway